For research use only. Not for therapeutic Use.
3,4′-Dihydroxyflavone(Cat No.:M051330) is a flavonoid compound with antioxidant and anti-inflammatory properties. Its mode of action involves acting as a natural plant pigment and a potent free radical scavenger. 3,4′-Dihydroxyflavone has been studied for its potential therapeutic effects in various medical applications. It shows promise as a neuroprotective agent, with research suggesting its ability to enhance cognitive function and memory. Additionally, it has demonstrated potential in treating conditions associated with inflammation, such as arthritis and allergies. Ongoing research explores its potential applications in the field of pharmaceuticals and nutraceuticals.
| Catalog Number | M051330 |
| CAS Number | 14919-49-4 |
| Molecular Formula | C15H10O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O4/c16-10-7-5-9(6-8-10)15-14(18)13(17)11-3-1-2-4-12(11)19-15/h1-8,16,18H |
| InChIKey | GPGOCTLAUAHUQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(O2)C3=CC=C(C=C3)O)O |
