For research use only. Not for therapeutic Use.
3,4-Dihydroxyphenylacetamide(Cat No.:M050510), commonly known as dopacetamide, is a chemical compound that features an acetamide group attached to a phenol ring which is further substituted with two hydroxyl groups at the 3 and 4 positions. This structural configuration is similar to dopamine, a crucial neurotransmitter, suggesting potential biological activities. Dopacetamide is studied for its potential neuroprotective properties and is of interest in pharmacological research, particularly in the context of neurological disorders such as Parkinson’s disease. It may influence dopamine pathways, offering insights into novel therapeutic approaches for managing neurodegenerative diseases.
CAS Number | 1129-53-9 |
Molecular Formula | C8H9NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3,4-dihydroxyphenyl)acetamide |
InChI | InChI=1S/C8H9NO3/c9-8(12)4-5-1-2-6(10)7(11)3-5/h1-3,10-11H,4H2,(H2,9,12) |
InChIKey | PFDFJMIGPOJBQV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CC(=O)N)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |