Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 3,4-Dimethoxybenzaldehyde-d3
For research use only. Not for therapeutic Use.
3,4-Dimethoxybenzaldehyde-d3 is a deuterated form of 3,4-dimethoxybenzaldehyde, featuring three deuterium atoms. This compound is used in chemical and pharmaceutical research to enhance the precision of analytical techniques such as NMR and mass spectrometry. 3,4-Dimethoxybenzaldehyde is commonly employed as an intermediate in the synthesis of various organic compounds, including pharmaceuticals and fragrances. The deuterium labeling allows for detailed studies of reaction mechanisms, metabolic pathways, and interactions with other molecules, making it valuable for understanding the behavior and transformation of methoxy-substituted benzaldehydes in different chemical environments.
Catalog Number | R017808 |
CAS Number | 143318-06-3 |
Synonyms | Veratraldehyde (7CI,8CI)-d3; 3,4-Dimethoxybenzaldehyde-d3; 3,4-Dimethoxybenzenecarbonal-d3; 4-O-Methylvanillin-d3; Methylvanillin-d3; NSC 24521-d3; NSC 8500-d3; Protocatechualdehyde Dimethyl Ether-d3; Protocatechuic Aldehyde Dimethyl Ether-d3; Vanill |
Molecular Formula | C9H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methoxy-4-(trideuteriomethoxy)benzaldehyde |
InChI | InChI=1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3/i1D3 |
InChIKey | WJUFSDZVCOTFON-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C=O)OC |