Home
>
Reference Standards>Organic Building Blocks>Reactive Oxygen Species> 3,4-DIMETHOXYCINNAMIC ACID
For research use only. Not for therapeutic Use.
3,4-Dimethoxycinnamic Acid is a derivative of cinnamic acid with two methoxy groups attached to the aromatic ring. It is known for its antioxidant and anti-inflammatory properties, making it useful in pharmaceutical and cosmetic research. This compound is studied for its potential therapeutic effects, particularly in reducing oxidative stress and inflammation. Additionally, 3,4-Dimethoxycinnamic Acid is employed in organic synthesis as an intermediate for synthesizing bioactive molecules, offering diverse applications in medicinal chemistry and natural product research.
CAS Number | 14737-89-4 |
Molecular Formula | C11H12O4 |
Purity | ≥95% |
Target | NF-κB |
Storage | Store at -20°C |
IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
SMILES | COC1=C(C=C(C=C1)C=CC(=O)O)OC |