For research use only. Not for therapeutic Use.
3,4-Dimethoxycinnamic Acid is a derivative of cinnamic acid featuring two methoxy groups on the aromatic ring. Known for its antioxidant and anti-inflammatory properties, it is widely studied for potential therapeutic applications, particularly in reducing oxidative stress and inflammation-related conditions. Additionally, it serves as an intermediate in organic synthesis for the production of bioactive molecules. 3,4-Dimethoxycinnamic Acid is also explored for its role in pharmaceutical research and its contribution to the development of new medicinal compounds.
CAS Number | 2316-26-9 |
Synonyms | 3,4-Di-O-methylcaffeic Acid; 3,4-Dimethoxycinnamic Acid; 3,4-Dimethoxyphenyl-2-propenoic Acid; 3-(3,4-Dimethoxyphenyl)-2-propenoic Acid;?3-(3,4-Dimethoxyphenyl)acrylic Acid; 3’,4’-Dimethoxycinnamic Acid; Caffeic Acid Dimethyl Ether; Methylferulic Aci |
Molecular Formula | C11H12O4 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
SMILES | COC1=C(C=C(C=C1)C=CC(=O)O)OC |