For research use only. Not for therapeutic Use.
3,4-Dimethoxyphenyl Isothiocyanate（Cat No.:L007067）, is an organic compound featuring an isothiocyanate functional group (-N=C=S) attached to a phenyl ring substituted with two methoxy groups (-OCH3) at the 3 and 4 positions. This compound is utilized in organic synthesis, particularly in the creation of thioureas, carbamates, and other sulfur-containing compounds. Its reactivity allows for diverse chemical transformations, making it valuable in the preparation of complex organic molecules.
| Catalog Number | L007067 |
| CAS Number | 33904-04-0 |
| Molecular Formula | C9H9NO2S |
| Purity | ≥95% |
| IUPAC Name | 4-isothiocyanato-1,2-dimethoxybenzene |
| InChI | InChI=1S/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
| InChIKey | LHPZZVZPOZPDDB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N=C=S)OC |
