For research use only. Not for therapeutic Use.
3,4-Dimethoxyphenylacetylene(Cat No.:L047023)is an aromatic compound featuring a phenyl ring with two methoxy groups and an acetylene (ethynyl) group. This compound is widely used in organic synthesis and pharmaceutical research as a building block for creating complex molecules, including potential drug candidates and fine chemicals. Its structure offers unique reactivity, particularly in cross-coupling and Sonogashira reactions, making it valuable for the synthesis of heterocycles and bioactive compounds. Researchers in medicinal chemistry utilize this compound to develop innovative therapies and explore new chemical transformations.
CAS Number | 4302-52-7 |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
IUPAC Name | 4-ethynyl-1,2-dimethoxybenzene |
InChI | InChI=1S/C10H10O2/c1-4-8-5-6-9(11-2)10(7-8)12-3/h1,5-7H,2-3H3 |
InChIKey | UWSHHXXCHBLOFO-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C#C)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |