For research use only. Not for therapeutic Use.
3,4-Dimethyl-1,2-cyclopentanedione (Cat.No:M061066) is a chemical compound used in organic synthesis. Its cyclic structure with two ketone functional groups makes it a versatile building block for various reactions, including the formation of complex molecules in pharmaceutical and agrochemical research. It serves as a valuable tool in the development of novel compounds.
Catalog Number | M061066 |
CAS Number | 13494-06-9 |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3,4-dimethylcyclopentane-1,2-dione |
InChI | InChI=1S/C7H10O2/c1-4-3-6(8)7(9)5(4)2/h4-5H,3H2,1-2H3 |
InChIKey | WGAVDEVFJDQIMZ-UHFFFAOYSA-N |
SMILES | CC1CC(=O)C(=O)C1C |