For research use only. Not for therapeutic Use.
3,4-Dimethylphenylhydrazine hydrochloride (Cat.No:R073144) is a chemical compound used in scientific research. It is a derivative of phenylhydrazine and is employed in the synthesis of various organic compounds. Its hydrochloride form enhances stability. This compound finds applications in pharmaceutical and chemical research settings.
| Catalog Number | R073144 |
| CAS Number | 60481-51-8 |
| Molecular Formula | C8H13ClN2 |
| Purity | ≥95% |
| IUPAC Name | (3,4-dimethylphenyl)hydrazine;hydrochloride |
| InChI | InChI=1S/C8H12N2.ClH/c1-6-3-4-8(10-9)5-7(6)2;/h3-5,10H,9H2,1-2H3;1H |
| InChIKey | YYMIOVAEQIEPET-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NN)C.Cl |
