3,4-Dimethylpyrazole Phosphate (CAT: R007395), also known as 3,4-DMPP, is recognized as a nitrification inhibitor that has undergone extensive safety testing. This compound is deemed safe based on standard toxicology and ecotoxicology evaluations. When applied to crops, 3,4-DMPP plays a crucial role in preventing nitrogen loss from soil, enhancing nitrogen use efficiency, and increasing crop yields. However, while research indicates that 3,4-DMPP may not directly influence net crop yield, it could potentially boost yields in alkaline soil conditions.
| Catalog Number | R007395 |
| CAS Number | 202842-98-6 |
| Synonyms | 3,4-Dimethyl-1H-pyrazole Phosphate; DMPP; Entec; |
| Molecular Formula | C5H11N2O4P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,5-dimethyl-1H-pyrazole;phosphoric acid |
| InChI | InChI=1S/C5H8N2.H3O4P/c1-4-3-6-7-5(4)2;1-5(2,3)4/h3H,1-2H3,(H,6,7);(H3,1,2,3,4) |
| InChIKey | LXKCHCXZBPLTAE-UHFFFAOYSA-N |
| SMILES | CC1=C(NN=C1)C.OP(=O)(O)O |
