For research use only. Not for therapeutic Use.
3,4-diphenyl-1H-pyrazol-5-amine(Cat No.:L007638), is a chemical compound featuring a pyrazole ring substituted with amino and phenyl groups at the 5, 3, and 4 positions, respectively. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, often utilizing it as a key intermediate or a scaffold for the design and synthesis of pharmaceutical agents.
CAS Number | 63633-46-5 |
Molecular Formula | C15H13N3 |
Purity | ≥95% |
IUPAC Name | 4,5-diphenyl-1H-pyrazol-3-amine |
InChI | InChI=1S/C15H13N3/c16-15-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h1-10H,(H3,16,17,18) |
InChIKey | JWPUMLMBTPMEQA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(NN=C2N)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |