For research use only. Not for therapeutic Use.
3,4-Furandicarboxylic acid(Cat No.:L047121)is a versatile compound widely used in pharmaceutical research, polymer science, and organic synthesis. Featuring two carboxylic acid groups on a furan ring, this compound is a key intermediate in the development of bioactive molecules and sustainable materials. It is particularly valuable in the synthesis of biodegradable polymers and as a building block for various fine chemicals. With its unique structure and reactivity, 3,4-Furandicarboxylic acid supports innovative research in green chemistry, offering high purity and consistent performance in diverse applications.
CAS Number | 3387-26-6 |
Molecular Formula | C6H4O5 |
Purity | ≥95% |
IUPAC Name | furan-3,4-dicarboxylic acid |
InChI | InChI=1S/C6H4O5/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
InChIKey | SYLAFCZSYRXBJF-UHFFFAOYSA-N |
SMILES | C1=C(C(=CO1)C(=O)O)C(=O)O |