For research use only. Not for therapeutic Use.
3,4-Hexanedione（Cat No.:L011133）is a versatile chemical compound used in organic synthesis and industrial applications. As a diketone with two adjacent carbonyl groups, it is a valuable intermediate in the production of various complex molecules, including pharmaceuticals, agrochemicals, and polymers. Its unique reactivity allows for diverse chemical transformations, making it essential in the development of fine chemicals and advanced materials. In research, 3,4-Hexanedione is particularly important for studying chemical pathways and mechanisms, contributing to the innovation of new products and technologies.
| Catalog Number | L011133 |
| CAS Number | 4437-51-8 |
| Molecular Formula | C6H10O2 |
| Purity | ≥95% |
| IUPAC Name | hexane-3,4-dione |
| InChI | InChI=1S/C6H10O2/c1-3-5(7)6(8)4-2/h3-4H2,1-2H3 |
| InChIKey | KVFQMAZOBTXCAZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(=O)CC |
