For research use only. Not for therapeutic Use.
3,4-Methylenedioxyphenethyl bromide(Cat No.:L010462)is an organic compound featuring a bromine atom attached to a phenethyl group, with a 3,4-methylenedioxy substituent on the benzene ring. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. Its bromide group allows for versatile reactivity in nucleophilic substitution and coupling reactions, making it a valuable building block for constructing complex molecular structures. Researchers in medicinal chemistry utilize this compound to explore innovative drug candidates and advanced chemical transformations.
CAS Number | 57587-02-7 |
Molecular Formula | C9H9BrO2 |
Purity | ≥95% |
IUPAC Name | 5-(2-bromoethyl)-1,3-benzodioxole |
InChI | InChI=1S/C9H9BrO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3-4,6H2 |
InChIKey | CCARPEUWUWIJPX-UHFFFAOYSA-N |
SMILES | C1OC2=C(O1)C=C(C=C2)CCBr |