For research use only. Not for therapeutic Use.
3,4,5-Tri-CQA (Cat No.:I012881) is a natural compound belonging to the group of chlorogenic acids (CQAs). It is found in various plants and is known for its antioxidant properties. 3,4,5-Tri-CQA has been studied for its potential health benefits, including anti-inflammatory and anticancer effects. It is considered a promising bioactive compound due to its ability to scavenge free radicals and reduce oxidative stress. Ongoing research aims to explore its therapeutic applications in the prevention and treatment of various diseases. 3,4,5-Tri-CQA shows promise as a natural compound with potential health-promoting properties.
Catalog Number | I012881 |
CAS Number | 86632-03-3 |
Synonyms | 3,4,5-Tricaffeoylquinic Acid; 3,4,5-tri-O-caffeoylquinic acid; (1S,3R,4S,5R)-3,4,5-Tris[(E)-3-(3,4- dihydroxyphenyl)acryloyloxy]-1-hydroxy-cyclohexanecarboxylic Acid |
Molecular Formula | C34H30O15 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | (3R,5R)-3,4,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxycyclohexane-1-carboxylic acid |
InChI | InChI=1S/C34H30O15/c35-21-7-1-18(13-24(21)38)4-10-29(41)47-27-16-34(46,33(44)45)17-28(48-30(42)11-5-19-2-8-22(36)25(39)14-19)32(27)49-31(43)12-6-20-3-9-23(37)26(40)15-20/h1-15,27-28,32,35-40,46H,16-17H2,(H,44,45)/b10-4+,11-5+,12-6+/t27-,28-,32?,34?/m1/s1 |
InChIKey | OAFXTKGAKYAFSI-JFPZSYFPSA-N |
SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)OC(=O)C=CC4=CC(=C(C=C4)O)O |