For research use only. Not for therapeutic Use.
3,4,5,4′-Tetramethoxystilbene(Cat No.:M127674), is a natural compound derived from certain plant sources. It has a stilbene structure with four methoxy groups attached to the phenyl rings. This compound exhibits antioxidant properties and shows potential in inhibiting cancer cell growth. It is being investigated for its therapeutic applications in cancer, cardiovascular diseases, and neurodegenerative disorders. 3,4,5,4′-Tetramethoxystilbene has attracted interest in the nutraceutical and pharmaceutical industries, but further research is needed to understand its mechanisms and ensure its safety and efficacy for clinical use.
CAS Number | 134029-62-2 |
Molecular Formula | C18H20O4 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | 2-8°C |
IUPAC Name | 1,2,3-trimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
InChI | InChI=1S/C18H20O4/c1-19-15-9-7-13(8-10-15)5-6-14-11-16(20-2)18(22-4)17(12-14)21-3/h5-12H,1-4H3/b6-5+ |
InChIKey | GGFQQRXTLIJXNY-AATRIKPKSA-N |
SMILES | COC1=CC=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |