For research use only. Not for therapeutic Use.
3,5-Bis(trifluoromethyl)-1,2-diaminobenzene(Cat No.:L047565)is a fluorinated aromatic compound featuring two trifluoromethyl groups at the 3 and 5 positions and two amine groups at the 1 and 2 positions on the benzene ring. This compound is valuable in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential drug candidates and agrochemicals. The trifluoromethyl groups enhance the compound’s lipophilicity and metabolic stability, while the amine groups allow for further chemical modifications. High purity ensures its effectiveness in advanced research, supporting drug discovery and development.
CAS Number | 367-65-7 |
Molecular Formula | C8H6F6N2 |
Purity | ≥95% |
IUPAC Name | 3,5-bis(trifluoromethyl)benzene-1,2-diamine |
InChI | InChI=1S/C8H6F6N2/c9-7(10,11)3-1-4(8(12,13)14)6(16)5(15)2-3/h1-2H,15-16H2 |
InChIKey | BRLIJPMFMGTIAW-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)N)C(F)(F)F |