For research use only. Not for therapeutic Use.
3,5-Bis(trifluoromethyl)benzoyl chloride (Cat.No:L003587) is a crucial chemical compound in organic synthesis. Its unique structure, featuring two trifluoromethyl groups, imparts valuable reactivity in various transformations. It serves as a versatile building block in the creation of specialized materials and pharmaceutical agents.
Catalog Number | L003587 |
CAS Number | 785-56-8 |
Molecular Formula | C9H3ClF6O |
Purity | ≥95% |
IUPAC Name | 3,5-bis(trifluoromethyl)benzoyl chloride |
InChI | InChI=1S/C9H3ClF6O/c10-7(17)4-1-5(8(11,12)13)3-6(2-4)9(14,15)16/h1-3H |
InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl |