For research use only. Not for therapeutic Use.
3,5-Di(2-pyridyl)pyrazole is a heterocyclic compound featuring a pyrazole core with two pyridyl groups at the 3 and 5 positions. It is commonly used in coordination chemistry and pharmaceutical research as a bidentate ligand, forming stable complexes with metal ions. This compound is valuable in catalysis, material science, and the development of metal-based therapeutic agents. Its ability to form strong metal-ligand bonds makes it useful for designing catalysts and studying bioinorganic interactions, contributing to advancements in synthetic chemistry and drug discovery.
CAS Number | 129485-83-2 |
Molecular Formula | C13H10N4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(3-pyridin-2-yl-1H-pyrazol-5-yl)pyridine |
InChI | InChI=1S/C13H10N4/c1-3-7-14-10(5-1)12-9-13(17-16-12)11-6-2-4-8-15-11/h1-9H,(H,16,17) |
InChIKey | IMDRKCUYKQQEAC-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=CC(=NN2)C3=CC=CC=N3 |