For research use only. Not for therapeutic Use.
3’,5’-Di-O-benzyl Entecavir(Cat No.:R057756)is a derivative of entecavir, a potent antiviral agent used in the treatment of chronic hepatitis B virus (HBV) infection. This modified compound features benzyl protection on the hydroxyl groups, enhancing its stability and enabling further chemical transformations in medicinal chemistry research. While entecavir itself inhibits HBV DNA polymerase and suppresses viral replication, 3’,5’-Di-O-benzyl Entecavir is primarily utilized as an intermediate in the synthesis of entecavir analogs. Its structural versatility supports the development of novel therapeutic agents targeting HBV.
CAS Number | 142217-81-0 |
Synonyms | 2-Amino-1,9-dihydro-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-6H-purin-6-one; [1S-(1α,3α,4β)]-2-Amino-1,9-dihydro-9-[2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-6H-purin-6-one; |
Molecular Formula | C26H27N5O3 |
Purity | ≥95% |
Storage | Store at 4℃ |
IUPAC Name | 2-amino-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-1H-purin-6-one |
InChI | InChI=1S/C26H27N5O3/c1-17-20(15-33-13-18-8-4-2-5-9-18)22(34-14-19-10-6-3-7-11-19)12-21(17)31-16-28-23-24(31)29-26(27)30-25(23)32/h2-11,16,20-22H,1,12-15H2,(H3,27,29,30,32)/t20-,21-,22-/m0/s1 |
InChIKey | KROVOOOAPHSWCR-FKBYEOEOSA-N |
SMILES | C=C1[C@H](C[C@@H]([C@H]1COCC2=CC=CC=C2)OCC3=CC=CC=C3)N4C=NC5=C4N=C(NC5=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |