For research use only. Not for therapeutic Use.
3,5-Di-tert-butyl-4-methoxybenzaldehyde(Cat No.:L015234)is a specialized aromatic aldehyde featuring two bulky tert-butyl groups and a methoxy substituent on a benzene ring. This compound is commonly used in organic synthesis and pharmaceutical research, serving as a key intermediate in the development of complex molecules. Its structure provides steric protection and influences reactivity, making it ideal for selective reactions in the synthesis of fine chemicals and active pharmaceutical ingredients (APIs). Researchers in medicinal chemistry and material science value this compound for creating innovative compounds with unique properties.
CAS Number | 74684-38-1 |
Molecular Formula | C16H24O2 |
Purity | ≥95% |
IUPAC Name | 3,5-ditert-butyl-4-methoxybenzaldehyde |
InChI | InChI=1S/C16H24O2/c1-15(2,3)12-8-11(10-17)9-13(14(12)18-7)16(4,5)6/h8-10H,1-7H3 |
InChIKey | JTILSNFKCZCROG-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C(C)(C)C)C=O |