For research use only. Not for therapeutic Use.
(3,5-Di(9H-carbazol-9-yl)phenyl)boronic acid(CAT: L000149) is a compound with vital applications in organic chemistry and material science. Its action mechanism involves serving as a critical intermediate for the synthesis of organic compounds and materials. In material chemistry, it plays a pivotal role in the development of specialized materials, particularly in the creation of organic semiconductors and optoelectronic devices.
CAS Number | 854952-51-5 |
Molecular Formula | C30H21BN2O2 |
Purity | ≥95% |
IUPAC Name | [3,5-di(carbazol-9-yl)phenyl]boronic acid |
InChI | InChI=1S/C30H21BN2O2/c34-31(35)20-17-21(32-27-13-5-1-9-23(27)24-10-2-6-14-28(24)32)19-22(18-20)33-29-15-7-3-11-25(29)26-12-4-8-16-30(26)33/h1-19,34-35H |
InChIKey | LHSCWNDROKEVMT-UHFFFAOYSA-N |