For research use only. Not for therapeutic Use.
3,5-Diamino-2-hydroxybenzoic acid hydrochloride(Cat No.:L013172)is an organic compound featuring amino and hydroxyl functional groups on a benzoic acid core. It is primarily used as an intermediate in the synthesis of pharmaceuticals, dyes, and other organic compounds. The presence of both amino and hydroxyl groups allows for versatile chemical modifications, making it valuable in drug development and medicinal chemistry. The hydrochloride salt form enhances its solubility and stability, making it easier to handle in various synthetic processes. This compound plays a crucial role in developing biologically active molecules and advanced materials.
CAS Number | 177960-41-7 |
Molecular Formula | C7H9ClN2O3 |
Purity | ≥95% |
IUPAC Name | 3,5-diamino-2-hydroxybenzoic acid;hydrochloride |
InChI | InChI=1S/C7H8N2O3.ClH/c8-3-1-4(7(11)12)6(10)5(9)2-3;/h1-2,10H,8-9H2,(H,11,12);1H |
InChIKey | JGWMDXDSLNLAFI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |