For research use only. Not for therapeutic Use.
3,5-Diaminosalicylic acid (Cat.No:M029609) is a chemical compound with potential applications in medicinal and chemical research. It contains two amino groups and a carboxylic acid group. This compound is often used as a precursor in the synthesis of various bioactive molecules and pharmaceutical intermediates, contributing to diverse scientific investigations.
CAS Number | 112725-89-0 |
Molecular Formula | C7H8N2O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3,5-diamino-2-hydroxybenzoic acid |
InChI | 1S/C7H8N2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,8-9H2,(H,11,12) |
InChIKey | HQURVGSRQBOZEX-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1N)O)C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |