For research use only. Not for therapeutic Use.
3,5-Dibromo-4-chloro-2-methoxypyridine(Cat No.:L007247), is a chemical compound important in organic synthesis and material science. This compound features a pyridine ring substituted with bromine, chlorine, and methoxy groups, offering diverse reactivity. Researchers employ it as a key intermediate in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Its strategic substitution pattern allows for further derivatization, enabling the creation of functional materials. The presence of halogen atoms enhances its reactivity and contributes to its utility as a valuable building block in various chemical transformations, fostering advancements in organic chemistry research.
CAS Number | 2386867-07-6 |
Molecular Formula | C6H4Br2ClNO |
Purity | ≥95% |
IUPAC Name | 3,5-dibromo-4-chloro-2-methoxypyridine |
InChI | InChI=1S/C6H4Br2ClNO/c1-11-6-4(8)5(9)3(7)2-10-6/h2H,1H3 |
InChIKey | SWCVDWUQJQGZJG-UHFFFAOYSA-N |
SMILES | COC1=NC=C(C(=C1Br)Cl)Br |