For research use only. Not for therapeutic Use.
3,5-Dibromo-4-methoxypyridine 1-oxide(Cat No.:L006714), is a chemical compound featuring a pyridine ring substituted with bromine atoms at the 3rd and 5th positions and a methoxy group at the 4th position. This compound is significant in organic synthesis, serving as a versatile building block for the creation of diverse functionalized pyridines. The presence of both bromine and methoxy groups enhances its reactivity, enabling various chemical transformations. Researchers utilize 3,5-Dibromo-4-methoxypyridine 1-oxide as an essential intermediate, contributing to the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, thus aiding advancements in drug discovery and materials science applications.
CAS Number | 650140-84-4 |
Molecular Formula | C6H5Br2NO2 |
Purity | ≥95% |
IUPAC Name | 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium |
InChI | InChI=1S/C6H5Br2NO2/c1-11-6-4(7)2-9(10)3-5(6)8/h2-3H,1H3 |
InChIKey | KAYQEYHOGFRTAL-UHFFFAOYSA-N |
SMILES | COC1=C(C=[N+](C=C1Br)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |