For research use only. Not for therapeutic Use.
3,5-Dibromoacetophenone is an aromatic compound featuring two bromine atoms substituted at the 3 and 5 positions of an acetophenone core. It is widely used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its reactive carbonyl group and bromine atoms allow for further functionalization in cross-coupling reactions and halogenation processes. This compound is valuable in medicinal chemistry for creating bioactive molecules, contributing to the development of therapeutic agents and specialized organic compounds.
CAS Number | 14401-73-1 |
Molecular Formula | C8H6Br2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(3,5-dibromophenyl)ethanone |
InChI | InChI=1S/C8H6Br2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
InChIKey | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=CC(=C1)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |