For research use only. Not for therapeutic Use.
3,5-Dichloro-2-hydroxybenzonitrile(CAT: L000001) is a key chemical compound with versatile applications. In the field of pharmaceuticals, it serves as a valuable intermediate in the synthesis of various medications. Its action method involves its participation as a crucial building block in the creation of bioactive compounds. In organic chemistry, this compound is utilized in the production of agrochemicals and fine chemicals, playing a pivotal role in diversifying chemical synthesis.
CAS Number | 3336-32-1 |
Molecular Formula | C7H3Cl2NO |
Purity | ≥95% |
IUPAC Name | 3,5-dichloro-2-hydroxybenzonitrile |
InChI | InChI=1S/C7H3Cl2NO/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2,11H |
InChIKey | ZTQVCIUXSLXAPV-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |