For research use only. Not for therapeutic Use.
3,5-Dichloro-4-fluorophenol(Cat No.:L013236)is a halogenated phenol characterized by its chlorine and fluorine substitutions, which significantly enhance its chemical reactivity and biological activity. This compound is primarily utilized in the synthesis of pesticides, pharmaceuticals, and other specialty chemicals. Its potent antifungal and antibacterial properties make it a valuable component in developing new antimicrobial agents. Additionally, the presence of fluorine increases its metabolic stability and lipophilicity, improving its efficacy in biological systems. 3,5-Dichloro-4-fluorophenol plays a crucial role in chemical research aimed at creating more effective and durable antimicrobial solutions.
CAS Number | 2995-04-2 |
Molecular Formula | C6H3Cl2FO |
Purity | ≥95% |
IUPAC Name | 3,5-dichloro-4-fluorophenol |
InChI | InChI=1S/C6H3Cl2FO/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
InChIKey | YCDCEIPNXTXMTJ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)F)Cl)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |