For research use only. Not for therapeutic Use.
3,5-Dichloropyridazin-4-amine is a chlorinated pyridazine derivative with chlorine atoms at the 3- and 5-positions and an amino group at the 4-position. This compound is commonly used as an intermediate in organic synthesis, particularly in pharmaceutical research, due to its reactivity and versatility. Its structure allows for diverse modifications, making it suitable for constructing bioactive molecules and agrochemicals. Known for its stability, 3,5-Dichloropyridazin-4-amine supports efficient synthetic pathways in medicinal chemistry and advanced material research applications.
CAS Number | 53180-76-0 |
Molecular Formula | C4H3Cl2N3 |
Purity | ≥95% |
IUPAC Name | 3,5-dichloropyridazin-4-amine |
InChI | InChI=1S/C4H3Cl2N3/c5-2-1-8-9-4(6)3(2)7/h1H,(H2,7,8) |
InChIKey | RPFJGTZUJUOCCL-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(N=N1)Cl)N)Cl |