Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3,5-Difluoro-4-(5-isopropyl-1,2,4-oxadiazol-3-YL)phenol
For research use only. Not for therapeutic Use.
3,5-Difluoro-4-(5-isopropyl-1,2,4-oxadiazol-3-yl)phenol(Cat No.:L010631)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a phenol ring with fluorine atoms at the 3 and 5 positions, and a 5-isopropyl-1,2,4-oxadiazole group attached at the 4-position. This combination of functional groups provides unique reactivity, making it valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals. The oxadiazole moiety adds to the compound’s potential biological activity, making it essential for researchers focused on drug discovery and medicinal chemistry.
CAS Number | 1914136-73-4 |
Molecular Formula | C11H10F2N2O2 |
Purity | ≥95% |
IUPAC Name | 3,5-difluoro-4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenol |
InChI | InChI=1S/C11H10F2N2O2/c1-5(2)11-14-10(15-17-11)9-7(12)3-6(16)4-8(9)13/h3-5,16H,1-2H3 |
InChIKey | ALIXSMOMSFSVBB-UHFFFAOYSA-N |
SMILES | CC(C)C1=NC(=NO1)C2=C(C=C(C=C2F)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |