For research use only. Not for therapeutic Use.
3,5-Difluoro-4-formylbenzoic acid is a high-purity compound used in pharmaceutical and chemical research. It features two fluorine atoms at the 3 and 5 positions and a formyl group at the 4 position of the benzoic acid ring. This versatile intermediate is valuable in the synthesis of bioactive molecules and functionalized aromatic compounds. Its unique structure contributes to its role in organic synthesis, especially in the design of targeted therapeutics and advanced chemical reagents for medicinal chemistry.
CAS Number | 736990-88-8 |
Molecular Formula | C8H4F2O3 |
Purity | ≥95% |
IUPAC Name | 3,5-difluoro-4-formylbenzoic acid |
InChI | InChI=1S/C8H4F2O3/c9-6-1-4(8(12)13)2-7(10)5(6)3-11/h1-3H,(H,12,13) |
InChIKey | FRAXEZGWRAVEIK-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)C=O)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |