For research use only. Not for therapeutic Use.
3,5-Difluoro-4-nitrobenzoic Acid(CAT: L031614) is a high-purity aromatic compound featuring fluorine and nitro functional groups on a benzoic acid backbone. This versatile molecule is widely used in pharmaceutical research and organic synthesis as a key intermediate in the development of bioactive compounds and fine chemicals. Its unique reactivity makes it particularly valuable in medicinal chemistry for synthesizing novel therapeutic agents and exploring advanced chemical pathways. With excellent stability and precise composition, 3,5-Difluoro-4-nitrobenzoic Acid ensures consistent and reliable performance, making it a critical tool for researchers advancing innovation in drug discovery and material science.
CAS Number | 1131580-60-3 |
Molecular Formula | C7H3F2NO4 |
Purity | ≥95% |
IUPAC Name | 3,5-difluoro-4-nitrobenzoic acid |
InChI | InChI=1S/C7H3F2NO4/c8-4-1-3(7(11)12)2-5(9)6(4)10(13)14/h1-2H,(H,11,12) |
InChIKey | CUDACLYZECMWDR-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)C(=O)O |