For research use only. Not for therapeutic Use.
(3,5-Difluoro-4-nitrophenyl)methanol(Cat No.:L032559)is a fluorinated aromatic compound widely used in pharmaceutical research and organic synthesis. This compound features two fluorine atoms and a nitro group on the phenyl ring, enhancing its reactivity and making it a valuable intermediate in the synthesis of various bioactive molecules. Its unique chemical structure is instrumental in the development of novel therapeutic agents and advanced materials. With high purity and stability, (3,5-Difluoro-4-nitrophenyl)methanol is essential for precise chemical modifications and research applications.
CAS Number | 1123172-89-3 |
Molecular Formula | C7H5F2NO3 |
Purity | ≥95% |
IUPAC Name | (3,5-difluoro-4-nitrophenyl)methanol |
InChI | InChI=1S/C7H5F2NO3/c8-5-1-4(3-11)2-6(9)7(5)10(12)13/h1-2,11H,3H2 |
InChIKey | MWMXVSGWUYOLQS-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)CO |