For research use only. Not for therapeutic Use.
3,5-Difluoro-4-propoxyphenylboronic acid is an organoboron compound featuring two fluorine atoms and a propoxy group on a phenyl ring, commonly used in pharmaceutical and organic synthesis. Its structure allows for versatile reactivity, especially in Suzuki-Miyaura cross-coupling reactions, making it valuable in creating complex organic molecules. The boronic acid group facilitates conjugation with various substrates, while the fluorine atoms enhance stability. This compound is particularly useful in medicinal chemistry for developing bioactive compounds and optimizing pharmacokinetic properties.
CAS Number | 2096331-43-8 |
Molecular Formula | C9H11BF2O3 |
Purity | ≥95% |
IUPAC Name | (3,5-difluoro-4-propoxyphenyl)boronic acid |
InChI | InChI=1S/C9H11BF2O3/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h4-5,13-14H,2-3H2,1H3 |
InChIKey | NGMFHAGRFNZKKZ-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C(=C1)F)OCCC)F)(O)O |