For research use only. Not for therapeutic Use.
3′,5′-Difluoroacetophenone(Cat No.:M021597)is a fluorinated aromatic ketone widely used in organic synthesis and pharmaceutical research. This compound features two fluorine atoms at the 3′ and 5′ positions of the acetophenone ring, making it a valuable building block for creating complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure allows for selective functionalization, enhancing the properties of target compounds. With high purity and reactivity, 3′,5′-Difluoroacetophenone is essential for advancing research in medicinal chemistry and material science.
CAS Number | 123577-99-1 |
Molecular Formula | C8H6F2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(3,5-difluorophenyl)ethanone |
InChI | InChI=1S/C8H6F2O/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3 |
InChIKey | OXJLDNSPGPBDCP-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=CC(=C1)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |