For research use only. Not for therapeutic Use.
3,5-Difluoroaniline(Cat No.:L016417)is a fluorinated aromatic amine widely used in pharmaceutical and chemical research. Featuring two fluorine atoms positioned at the 3- and 5-positions on the aniline ring, this compound is a valuable intermediate in the synthesis of various bioactive molecules, including pharmaceuticals, agrochemicals, and dyes. Its fluorinated structure enhances the compound’s reactivity and stability, making it particularly useful in developing therapeutic agents and materials with unique properties. 3,5-Difluoroaniline plays a crucial role in medicinal chemistry, enabling the exploration of novel chemical pathways and drug candidates.
CAS Number | 372-39-4 |
Molecular Formula | C6H5F2N |
Purity | ≥95% |
IUPAC Name | 3,5-difluoroaniline |
InChI | InChI=1S/C6H5F2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2 |
InChIKey | KQOIBXZRCYFZSO-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1F)F)N |