For research use only. Not for therapeutic Use.
3,5-Dihydroxybenzoic Acid(Cat No.:R054882), also known as α-resorcylic acid, is a naturally occurring phenolic compound with antioxidant, anti-inflammatory, and antimicrobial properties. It is found in various plants and has been studied for its ability to scavenge free radicals and protect cells from oxidative stress. In pharmaceutical and biochemical research, 3,5-Dihydroxybenzoic Acid is explored for its potential therapeutic applications in treating conditions related to inflammation and oxidative damage. Additionally, it serves as an intermediate in the synthesis of various organic compounds, making it valuable in chemical and drug development.
CAS Number | 99-10-5 |
Synonyms | α-Resorcylic Acid; 5-Carboxyresorcinol; NSC 22948; DHBA; |
Molecular Formula | C7H6O4 |
Purity | ≥95% |
Target | Hydroxycarboxylic Acid Receptors |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at RT |
IUPAC Name | 3,5-dihydroxybenzoic acid |
InChI | InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) |
InChIKey | UYEMGAFJOZZIFP-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)O)C(=O)O |