For research use only. Not for therapeutic Use.
3,5-Dihydroxynaphthalene-2-carboxylic acid, also known as gentisic acid, is a naturally occurring compound found in various plants. It possesses antioxidant and anti-inflammatory properties, making it valuable in traditional medicine and as a potential therapeutic agent in modern research. Gentisic acid has been studied for its role in mitigating oxidative stress-related diseases and promoting overall health, highlighting its importance in biomedical studies.
CAS Number | 89-35-0 |
Synonyms | UBP551; |
Molecular Formula | C11H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,5-dihydroxynaphthalene-2-carboxylic acid |
InChI | InChI=1S/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15) |
InChIKey | YELLAPKUWRTITI-UHFFFAOYSA-N |
SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)O)C(=O)O |