For research use only. Not for therapeutic Use.
3,5-Dimethylisoxazole-4-carbonyl chloride (Cat.No:L003512) is a crucial intermediate in organic synthesis. Its reactive carbonyl chloride group makes it a valuable building block for the preparation of various functionalized molecules. This compound finds applications in pharmaceutical and agrochemical industries, serving as a key component in the synthesis of bioactive compounds. Its versatility and reactivity underscore its significance in the realm of modern chemical research and development.
CAS Number | 31301-45-8 |
Molecular Formula | C6H6ClNO2 |
Purity | ≥95% |
IUPAC Name | 3,5-dimethyl-1,2-oxazole-4-carbonyl chloride |
InChI | InChI=1S/C6H6ClNO2/c1-3-5(6(7)9)4(2)10-8-3/h1-2H3 |
InChIKey | MPYGFFPGJMGVSW-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NO1)C)C(=O)Cl |