For research use only. Not for therapeutic Use.
3,5-Dimethylphenylthiourea(CAT: L015244) is a thiourea derivative commonly utilized in chemical and pharmaceutical research. Its structure features a phenyl ring substituted with two methyl groups at the 3- and 5-positions, along with a thiourea group (-CSNH2), which imparts unique reactivity. This compound serves as a precursor or intermediate in the synthesis of various heterocyclic compounds and has potential applications in the development of agrochemicals, pharmaceuticals, and other biologically active molecules. Its sulfur-containing functional group also makes it of interest for research involving enzyme inhibition and coordination chemistry.
CAS Number | 97480-60-9 |
Molecular Formula | C9H12N2S |
Purity | ≥95% |
IUPAC Name | (3,5-dimethylphenyl)thiourea |
InChI | InChI=1S/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
InChIKey | XOAYHDJRYDSPJZ-UHFFFAOYSA-N |