For research use only. Not for therapeutic Use.
3,5-Dimethylpyrazinol (Cat No.:R020043) is a chemical compound. It is a pyrazine derivative, featuring methyl groups substituted at positions 3 and 5 of the pyrazine ring. This compound is used as a building block in organic synthesis, particularly in the preparation of various organic molecules and pharmaceuticals. Its modified pyrazine structure enhances its reactivity and versatility in chemical reactions, making it valuable for creating diverse compounds. 3,5-Dimethylpyrazinol’s significance lies in its role as a key intermediate in the development of functional compounds with potential applications across industries, including the pharmaceutical and chemical sectors.
CAS Number | 60187-00-0 |
Synonyms | 3,5-Dimethyl-2(1H)-pyrazinone; |
Molecular Formula | C6H8N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,5-dimethyl-1H-pyrazin-2-one |
InChI | InChI=1S/C6H8N2O/c1-4-3-7-6(9)5(2)8-4/h3H,1-2H3,(H,7,9) |
InChIKey | AJYKJVCIKQEVCF-UHFFFAOYSA-N |
SMILES | CC1=CNC(=O)C(=N1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |