(3,5-Diphosphonophenyl)phosphonic acid(Cat No.:L002998)is a specialized organophosphorus compound used in various fields, including materials science, biochemistry, and pharmaceutical research. This molecule, characterized by three phosphonic acid groups attached to a phenyl ring, exhibits strong chelating properties and is commonly employed in the synthesis of metal-organic frameworks (MOFs) and as an additive in corrosion inhibitors. Its structure also makes it valuable in developing bone-targeting agents and bisphosphonate drugs. With high stability and reactivity, (3,5-Diphosphonophenyl)phosphonic acid supports cutting-edge research and industrial applications.
Catalog Number | L002998 |
CAS Number | 4672-29-1 |
Molecular Formula | C6H9O9P3 |
Purity | 95% |
IUPAC Name | (3,5-diphosphonophenyl)phosphonic acid |
InChI | InChI=1S/C6H9O9P3/c7-16(8,9)4-1-5(17(10,11)12)3-6(2-4)18(13,14)15/h1-3H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15) |
InChIKey | OARRIBWWCWLELO-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1P(=O)(O)O)P(=O)(O)O)P(=O)(O)O |