For research use only. Not for therapeutic Use.
3,5,3’,5’-Tetraiodo thyrolactic acid (T4-lactic acid) is a derivative of thyroxine (T4), a thyroid hormone. This compound combines T4 with lactic acid, forming a conjugate that can modulate thyroid hormone activity. T4-lactic acid is used in research to investigate thyroid hormone metabolism and signaling pathways. Its unique structure allows for studying the interactions and effects of modified thyroid hormones, which may have implications in understanding thyroid-related disorders and developing potential therapeutic interventions.
CAS Number | 7069-47-8 |
Synonyms | α-Hydroxy-4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzenepropanoic Acid; 3-[4-(4-Hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]lactic Acid; |
Molecular Formula | C15H10I4O5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-hydroxy-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
InChI | InChI=1S/C15H10I4O5/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,20-21H,3H2,(H,22,23) |
InChIKey | JEAVLSCJUQYFHT-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |