For research use only. Not for therapeutic Use.
3,5,6-Trichloro-1,2,4-triazine(CAT: L015295) is a high-purity heterocyclic compound featuring three chlorine atoms substituted on a triazine ring. This versatile molecule is widely used in chemical synthesis as a key intermediate, particularly in the production of herbicides, agrochemicals, and specialty materials. Its high reactivity makes it ideal for applications such as cross-coupling reactions and nucleophilic substitutions. 3,5,6-Trichloro-1,2,4-triazine is also valuable in polymer chemistry and material science, where it is employed as a building block for advanced materials. Its well-defined structure and chemical properties support innovative research in fine chemical production and industrial applications.
CAS Number | 873-41-6 |
Molecular Formula | C3Cl3N3 |
Purity | ≥95% |
IUPAC Name | 3,5,6-trichloro-1,2,4-triazine |
InChI | InChI=1S/C3Cl3N3/c4-1-2(5)8-9-3(6)7-1 |
InChIKey | YHKUFWFVZIIVDL-UHFFFAOYSA-N |
SMILES | C1(=C(N=NC(=N1)Cl)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |