For research use only. Not for therapeutic Use.
3,6-Di-2-pyridyl-1,2,4,5-tetrazine is a heterocyclic compound commonly used in chemical research for its role in bioorthogonal chemistry and click reactions. Its tetrazine core allows it to react with strained alkynes in an inverse electron-demand Diels-Alder reaction, making it highly valuable in bioconjugation and labeling studies. This compound is frequently employed in drug development, molecular imaging, and the creation of functionalized biomolecules, enabling precise and efficient modifications in biological and synthetic systems.
Catalog Number | M120871 |
CAS Number | 1671-87-0 |
Synonyms | 3,6-di(pyridin-2-yl)-1,2,4,5-tetrazine; 3,6-Di(2-pyridyl)-1,2,4,5-tetrazine |
Molecular Formula | C12H8N6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,6-dipyridin-2-yl-1,2,4,5-tetrazine |
InChI | InChI=1S/C12H8N6/c1-3-7-13-9(5-1)11-15-17-12(18-16-11)10-6-2-4-8-14-10/h1-8H |
InChIKey | JFBIRMIEJBPDTQ-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=NN=C(N=N2)C3=CC=CC=N3 |