For research use only. Not for therapeutic Use.
3,6-Dibromo-4-methylpyridazine(CAT: L031727) is a heterocyclic compound that contains a pyridazine ring, with two bromine atoms at the 3 and 6 positions, and a methyl group at the 4 position. The dibromo substitution makes the compound highly reactive in cross-coupling reactions, such as Suzuki or Buchwald-Hartwig reactions, making it useful as an intermediate for introducing more complex functional groups. The presence of the pyridazine ring, a six-membered heterocycle with two nitrogen atoms, lends unique electronic properties that are valuable in medicinal chemistry and materials science. This compound is often employed in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.
CAS Number | 89284-10-6 |
Molecular Formula | C5H4Br2N2 |
Purity | ≥95% |
IUPAC Name | 3,6-dibromo-4-methylpyridazine |
InChI | InChI=1S/C5H4Br2N2/c1-3-2-4(6)8-9-5(3)7/h2H,1H3 |
InChIKey | RQBKJQQWXNALHH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |