For research use only. Not for therapeutic Use.
3,6-Dibromo-9-ethylcarbazole(Cat No.:L015225)is a specialized compound used in pharmaceutical research, organic synthesis, and material science. Featuring two bromine atoms on the carbazole core with an ethyl group at the 9-position, this compound is crucial for the development of various bioactive molecules and organic electronic materials. Its structure allows for selective reactivity, making it valuable in the synthesis of complex heterocyclic compounds and polymers. High purity and consistent quality ensure reliable performance in advanced research, supporting innovations in medicinal chemistry and optoelectronic applications.
CAS Number | 33255-13-9 |
Molecular Formula | C14H11Br2N |
Purity | ≥95% |
IUPAC Name | 3,6-dibromo-9-ethylcarbazole |
InChI | InChI=1S/C14H11Br2N/c1-2-17-13-5-3-9(15)7-11(13)12-8-10(16)4-6-14(12)17/h3-8H,2H2,1H3 |
InChIKey | GZBJRMVGNVDUCO-UHFFFAOYSA-N |
SMILES | CCN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |