For research use only. Not for therapeutic Use.
3,6-Dibromobenzene-1,2-diol(Cat No.:L024882)is a brominated derivative of benzene, characterized by the presence of two bromine atoms and two hydroxyl groups. This diol is particularly important in organic synthesis and pharmaceutical research, where it serves as an intermediate in the preparation of various biologically active compounds. The bromine atoms enhance its reactivity, making it suitable for substitutions and other chemical transformations. Its structure is critical in the synthesis of polymers, dyes, and several therapeutic agents. 3,6-Dibromobenzene-1,2-diol is valued for its versatility and functional importance in advanced chemical processes and product development.
CAS Number | 123433-20-5 |
Molecular Formula | C6H4Br2O2 |
Purity | ≥95% |
IUPAC Name | 3,6-dibromobenzene-1,2-diol |
InChI | InChI=1S/C6H4Br2O2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H |
InChIKey | OFPHOXBUDUVEAS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1Br)O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |