For research use only. Not for therapeutic Use.
3,6-Dibromoimidazo[1,2-a]pyridine(CAT: L037375) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring an imidazo[1,2-a]pyridine core with bromine atoms at the 3 and 6 positions, this compound serves as a versatile building block in the synthesis of bioactive molecules, including drug candidates and advanced materials. Its unique structure and reactivity make it suitable for applications in medicinal chemistry, particularly in the development of enzyme inhibitors and receptor modulators. 3,6-Dibromoimidazo[1,2-a]pyridine ensures consistent performance and reliability, supporting innovative research in drug discovery and synthetic chemistry.
CAS Number | 1065074-14-7 |
Molecular Formula | C7H4Br2N2 |
Purity | ≥95% |
IUPAC Name | 3,6-dibromoimidazo[1,2-a]pyridine |
InChI | InChI=1S/C7H4Br2N2/c8-5-1-2-7-10-3-6(9)11(7)4-5/h1-4H |
InChIKey | OREHQDRYMUUZGL-UHFFFAOYSA-N |
SMILES | C1=CC2=NC=C(N2C=C1Br)Br |